C18H15N5OS — CID 53317872
6-phenyl-2-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4,5-dihydropyridazin-3-one (PubChem CID 53317872) has the molecular formula C18H15N5OS and a molecular weight of 349.42 g/mol. Its IUPAC name is 6-phenyl-2-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4,5-dihydropyridazin-3-one.
| Compound Name | 6-phenyl-2-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4,5-dihydropyridazin-3-one |
|---|---|
| PubChem CID | 53317872 |
| Molecular Formula | C18H15N5OS |
| Molecular Weight | 349.42 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 6-phenyl-2-(4-phenyl-5-sulfanylidene-1H-1,2,4-triazol-3-yl)-4,5-dihydropyridazin-3-one |
| SMILES | O=C1CCC(c2ccccc2)=NN1c1n[nH]c(=S)n1-c1ccccc1 |
| InChI | InChI=1S/C18H15N5OS/c24-16-12-11-15(13-7-3-1-4-8-13)21-23(16)17-19-20-18(25)22(17)14-9-5-2-6-10-14/h1-10H,11-12H2,(H,20,25) |
| InChIKey | YLWUIJLQNQTFHQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.42 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|