About 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid
1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid (PubChem CID 53317886) has the molecular formula C19H22Cl2N4O3
and a molecular weight of 425.32 g/mol. Its IUPAC name is 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid |
| PubChem CID | 53317886 |
| Molecular Formula | C19H22Cl2N4O3 |
| Molecular Weight | 425.32 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid |
| SMILES | COc1nc(NCCc2ccc(Cl)cc2Cl)cc(N2CCC(C(=O)O)CC2)n1 |
| InChI | InChI=1S/C19H22Cl2N4O3/c1-28-19-23-16(22-7-4-12-2-3-14(20)10-15(12)21)11-17(24-19)25-8-5-13(6-9-25)18(26)27/h2-3,10-11,13H,4-9H2,1H3,(H,26,27)(H,22,23,24) |
| InChIKey | BYAWAXOLOBCSIC-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 87.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 425.32 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid?
The IUPAC name of 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid (CID 53317886) is 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid?
The canonical SMILES for 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid is COc1nc(NCCc2ccc(Cl)cc2Cl)cc(N2CCC(C(=O)O)CC2)n1.
What is the InChIKey of 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid?
The InChIKey is BYAWAXOLOBCSIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H22Cl2N4O3/c1-28-19-23-16(22-7-4-12-2-3-14(20)10-15(12)21)11-17(24-19)25-8-5-13(6-9-25)18(26)27/h2-3,10-11,13H,4-9H2,1H3,(H,26,27)(H,22,23,24).
What are the key properties of 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid?
1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid has a molecular weight of 425.32 g/mol, XLogP of 3.75, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[6-[2-(2,4-dichlorophenyl)ethylamino]-2-methoxypyrimidin-4-yl]piperidine-4-carboxylic acid is sourced from PubChem (CID 53317886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).