C22H26N6O2 — CID 53317924
N-methyl-N-[4-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]oxyphenyl]acetamide (PubChem CID 53317924) has the molecular formula C22H26N6O2 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-methyl-N-[4-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]oxyphenyl]acetamide.
| Compound Name | N-methyl-N-[4-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]oxyphenyl]acetamide |
|---|---|
| PubChem CID | 53317924 |
| Molecular Formula | C22H26N6O2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.21 |
| IUPAC Name | N-methyl-N-[4-[1-(2,6,7,12-tetrazatricyclo[7.5.0.03,7]tetradeca-1,3,5,8-tetraen-8-yl)azetidin-3-yl]oxyphenyl]acetamide |
| SMILES | CC(=O)N(C)c1ccc(OC2CN(c3c4c(nc5ccnn35)CCNCC4)C2)cc1 |
| InChI | InChI=1S/C22H26N6O2/c1-15(29)26(2)16-3-5-17(6-4-16)30-18-13-27(14-18)22-19-7-10-23-11-8-20(19)25-21-9-12-24-28(21)22/h3-6,9,12,18,23H,7-8,10-11,13-14H2,1-2H3 |
| InChIKey | CJKLNGBOTSHTRK-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |