C13H18O3 — CID 53317967
(E,2S,3R)-tridec-9-en-4,6-diyne-2,3,8-triol (PubChem CID 53317967) has the molecular formula C13H18O3 and a molecular weight of 222.28 g/mol. Its IUPAC name is (E,2S,3R)-tridec-9-en-4,6-diyne-2,3,8-triol.
| Compound Name | (E,2S,3R)-tridec-9-en-4,6-diyne-2,3,8-triol |
|---|---|
| PubChem CID | 53317967 |
| Molecular Formula | C13H18O3 |
| Molecular Weight | 222.28 g/mol |
| Exact Mass | 222.13 |
| IUPAC Name | (E,2S,3R)-tridec-9-en-4,6-diyne-2,3,8-triol |
| SMILES | CCC/C=C/C(O)C#CC#C[C@@H](O)[C@H](C)O |
| InChI | InChI=1S/C13H18O3/c1-3-4-5-8-12(15)9-6-7-10-13(16)11(2)14/h5,8,11-16H,3-4H2,1-2H3/b8-5+/t11-,12?,13+/m0/s1 |
| InChIKey | REGOORXTKQVNOO-XWRSLROKSA-N |
| XLogP | 0.45 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.28 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|