C12H16O3 — CID 53317968
(2S,3R)-10-methylundec-9-en-4,6-diyne-2,3,8-triol (PubChem CID 53317968) has the molecular formula C12H16O3 and a molecular weight of 208.26 g/mol. Its IUPAC name is (2S,3R)-10-methylundec-9-en-4,6-diyne-2,3,8-triol.
| Compound Name | (2S,3R)-10-methylundec-9-en-4,6-diyne-2,3,8-triol |
|---|---|
| PubChem CID | 53317968 |
| Molecular Formula | C12H16O3 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.11 |
| IUPAC Name | (2S,3R)-10-methylundec-9-en-4,6-diyne-2,3,8-triol |
| SMILES | CC(C)=CC(O)C#CC#C[C@@H](O)[C@H](C)O |
| InChI | InChI=1S/C12H16O3/c1-9(2)8-11(14)6-4-5-7-12(15)10(3)13/h8,10-15H,1-3H3/t10-,11?,12+/m0/s1 |
| InChIKey | OKPRDFLKKLSGAZ-ASKATJPDSA-N |
| XLogP | 0.06 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|