C14H20O3 — CID 53317969
(6R,7S)-1-cyclohexylocta-2,4-diyne-1,6,7-triol (PubChem CID 53317969) has the molecular formula C14H20O3 and a molecular weight of 236.31 g/mol. Its IUPAC name is (6R,7S)-1-cyclohexylocta-2,4-diyne-1,6,7-triol.
| Compound Name | (6R,7S)-1-cyclohexylocta-2,4-diyne-1,6,7-triol |
|---|---|
| PubChem CID | 53317969 |
| Molecular Formula | C14H20O3 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (6R,7S)-1-cyclohexylocta-2,4-diyne-1,6,7-triol |
| SMILES | C[C@H](O)[C@H](O)C#CC#CC(O)C1CCCCC1 |
| InChI | InChI=1S/C14H20O3/c1-11(15)13(16)9-5-6-10-14(17)12-7-3-2-4-8-12/h11-17H,2-4,7-8H2,1H3/t11-,13+,14?/m0/s1 |
| InChIKey | VWVPPMSTTCVFIG-MKDGSZCOSA-N |
| XLogP | 0.68 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|