C13H18N6O2S — CID 53318022
2,7-dimorpholin-4-yl-[1,3]thiazolo[4,5-d]pyrimidin-5-amine (PubChem CID 53318022) has the molecular formula C13H18N6O2S and a molecular weight of 322.39 g/mol. Its IUPAC name is 2,7-dimorpholin-4-yl-[1,3]thiazolo[4,5-d]pyrimidin-5-amine.
| Compound Name | 2,7-dimorpholin-4-yl-[1,3]thiazolo[4,5-d]pyrimidin-5-amine |
|---|---|
| PubChem CID | 53318022 |
| Molecular Formula | C13H18N6O2S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.12 |
| IUPAC Name | 2,7-dimorpholin-4-yl-[1,3]thiazolo[4,5-d]pyrimidin-5-amine |
| SMILES | Nc1nc(N2CCOCC2)c2sc(N3CCOCC3)nc2n1 |
| InChI | InChI=1S/C13H18N6O2S/c14-12-15-10-9(11(17-12)18-1-5-20-6-2-18)22-13(16-10)19-3-7-21-8-4-19/h1-8H2,(H2,14,15,17) |
| InChIKey | IRZSFBJKLJHCEM-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |