About phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone
phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone (PubChem CID 53318036) has the molecular formula C22H20N6O2
and a molecular weight of 400.44 g/mol. Its IUPAC name is phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone.
Molecular Properties
| Compound Name | phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone |
| PubChem CID | 53318036 |
| Molecular Formula | C22H20N6O2 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.16 |
| IUPAC Name | phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone |
| SMILES | O=C(c1ccccc1)N1CCC(n2cc(-c3nnc(-c4ccccc4)o3)nn2)CC1 |
| InChI | InChI=1S/C22H20N6O2/c29-22(17-9-5-2-6-10-17)27-13-11-18(12-14-27)28-15-19(23-26-28)21-25-24-20(30-21)16-7-3-1-4-8-16/h1-10,15,18H,11-14H2 |
| InChIKey | BNMWJOVCZVHHQR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 89.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone?
The IUPAC name of phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone (CID 53318036) is phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone.
What is the SMILES notation for phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone?
The canonical SMILES for phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone is O=C(c1ccccc1)N1CCC(n2cc(-c3nnc(-c4ccccc4)o3)nn2)CC1.
What is the InChIKey of phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone?
The InChIKey is BNMWJOVCZVHHQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H20N6O2/c29-22(17-9-5-2-6-10-17)27-13-11-18(12-14-27)28-15-19(23-26-28)21-25-24-20(30-21)16-7-3-1-4-8-16/h1-10,15,18H,11-14H2.
What are the key properties of phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone?
phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone has a molecular weight of 400.44 g/mol, XLogP of 3.47, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl-[4-[4-(5-phenyl-1,3,4-oxadiazol-2-yl)triazol-1-yl]piperidin-1-yl]methanone is sourced from PubChem (CID 53318036), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).