About 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one
5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one (PubChem CID 53318038) has the molecular formula C14H18N2OS
and a molecular weight of 262.38 g/mol. Its IUPAC name is 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one.
Molecular Properties
| Compound Name | 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one |
| PubChem CID | 53318038 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one |
| SMILES | CC(C)(C)c1ccc(SCc2cc(=O)[nH][nH]2)cc1 |
| InChI | InChI=1S/C14H18N2OS/c1-14(2,3)10-4-6-12(7-5-10)18-9-11-8-13(17)16-15-11/h4-8H,9H2,1-3H3,(H2,15,16,17) |
| InChIKey | NPPOFMQIBNYYES-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one?
The IUPAC name of 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one (CID 53318038) is 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one.
What is the SMILES notation for 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one?
The canonical SMILES for 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one is CC(C)(C)c1ccc(SCc2cc(=O)[nH][nH]2)cc1.
What is the InChIKey of 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one?
The InChIKey is NPPOFMQIBNYYES-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2OS/c1-14(2,3)10-4-6-12(7-5-10)18-9-11-8-13(17)16-15-11/h4-8H,9H2,1-3H3,(H2,15,16,17).
What are the key properties of 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one?
5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one has a molecular weight of 262.38 g/mol, XLogP of 3.29, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4-tert-butylphenyl)sulfanylmethyl]-1,2-dihydropyrazol-3-one is sourced from PubChem (CID 53318038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).