About 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide
4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide (PubChem CID 53318083) has the molecular formula C23H22ClN5O
and a molecular weight of 419.92 g/mol. Its IUPAC name is 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide.
Molecular Properties
| Compound Name | 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide |
| PubChem CID | 53318083 |
| Molecular Formula | C23H22ClN5O |
| Molecular Weight | 419.92 g/mol |
| Exact Mass | 419.15 |
| IUPAC Name | 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide |
| SMILES | CC(C)CN(NC(=O)c1ccc(Cc2ccccc2)cc1)c1nc(C#N)ncc1Cl |
| InChI | InChI=1S/C23H22ClN5O/c1-16(2)15-29(22-20(24)14-26-21(13-25)27-22)28-23(30)19-10-8-18(9-11-19)12-17-6-4-3-5-7-17/h3-11,14,16H,12,15H2,1-2H3,(H,28,30) |
| InChIKey | HYUNQJGZYLVVPB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.92 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide?
The IUPAC name of 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide (CID 53318083) is 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide.
What is the SMILES notation for 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide?
The canonical SMILES for 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide is CC(C)CN(NC(=O)c1ccc(Cc2ccccc2)cc1)c1nc(C#N)ncc1Cl.
What is the InChIKey of 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide?
The InChIKey is HYUNQJGZYLVVPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22ClN5O/c1-16(2)15-29(22-20(24)14-26-21(13-25)27-22)28-23(30)19-10-8-18(9-11-19)12-17-6-4-3-5-7-17/h3-11,14,16H,12,15H2,1-2H3,(H,28,30).
What are the key properties of 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide?
4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide has a molecular weight of 419.92 g/mol, XLogP of 4.40, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-N'-(5-chloro-2-cyanopyrimidin-4-yl)-N'-(2-methylpropyl)benzohydrazide is sourced from PubChem (CID 53318083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).