About N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide
N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide (PubChem CID 53318159) has the molecular formula C20H21NO4
and a molecular weight of 339.39 g/mol. Its IUPAC name is N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide.
Molecular Properties
| Compound Name | N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide |
| PubChem CID | 53318159 |
| Molecular Formula | C20H21NO4 |
| Molecular Weight | 339.39 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)/C=C/c2ccc(O)c(O)c2)cc1 |
| InChI | InChI=1S/C20H21NO4/c1-13(2)11-20(25)21-16-7-5-15(6-8-16)17(22)9-3-14-4-10-18(23)19(24)12-14/h3-10,12-13,23-24H,11H2,1-2H3,(H,21,25)/b9-3+ |
| InChIKey | JXSWWEQWZBJLIP-YCRREMRBSA-N |
| XLogP | 3.98 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.39 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide?
The IUPAC name of N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide (CID 53318159) is N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide.
What is the SMILES notation for N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide?
The canonical SMILES for N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide is CC(C)CC(=O)Nc1ccc(C(=O)/C=C/c2ccc(O)c(O)c2)cc1.
What is the InChIKey of N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide?
The InChIKey is JXSWWEQWZBJLIP-YCRREMRBSA-N. The full InChI is InChI=1S/C20H21NO4/c1-13(2)11-20(25)21-16-7-5-15(6-8-16)17(22)9-3-14-4-10-18(23)19(24)12-14/h3-10,12-13,23-24H,11H2,1-2H3,(H,21,25)/b9-3+.
What are the key properties of N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide?
N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide has a molecular weight of 339.39 g/mol, XLogP of 3.98, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]phenyl]-3-methylbutanamide is sourced from PubChem (CID 53318159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).