C23H25F3N2O5S — CID 53318186
[5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]-(5-morpholin-4-yl-1,3-dihydroisoindol-2-yl)methanone (PubChem CID 53318186) has the molecular formula C23H25F3N2O5S and a molecular weight of 498.52 g/mol. Its IUPAC name is [5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]-(5-morpholin-4-yl-1,3-dihydroisoindol-2-yl)methanone.
| Compound Name | [5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]-(5-morpholin-4-yl-1,3-dihydroisoindol-2-yl)methanone |
|---|---|
| PubChem CID | 53318186 |
| Molecular Formula | C23H25F3N2O5S |
| Molecular Weight | 498.52 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | [5-methylsulfonyl-2-[(2S)-1,1,1-trifluoropropan-2-yl]oxyphenyl]-(5-morpholin-4-yl-1,3-dihydroisoindol-2-yl)methanone |
| SMILES | C[C@H](Oc1ccc(S(C)(=O)=O)cc1C(=O)N1Cc2ccc(N3CCOCC3)cc2C1)C(F)(F)F |
| InChI | InChI=1S/C23H25F3N2O5S/c1-15(23(24,25)26)33-21-6-5-19(34(2,30)31)12-20(21)22(29)28-13-16-3-4-18(11-17(16)14-28)27-7-9-32-10-8-27/h3-6,11-12,15H,7-10,13-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | PSDSFAHHQSHIOM-HNNXBMFYSA-N |
| XLogP | 3.41 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.52 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|