C23H18F3N5O2 — CID 53318249
methyl 3-(cyclopropylamino)-5-[3-(trifluoromethyl)anilino]pyrimido[4,5-c]quinoline-8-carboxylate (PubChem CID 53318249) has the molecular formula C23H18F3N5O2 and a molecular weight of 453.42 g/mol. Its IUPAC name is methyl 3-(cyclopropylamino)-5-[3-(trifluoromethyl)anilino]pyrimido[4,5-c]quinoline-8-carboxylate.
| Compound Name | methyl 3-(cyclopropylamino)-5-[3-(trifluoromethyl)anilino]pyrimido[4,5-c]quinoline-8-carboxylate |
|---|---|
| PubChem CID | 53318249 |
| Molecular Formula | C23H18F3N5O2 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | methyl 3-(cyclopropylamino)-5-[3-(trifluoromethyl)anilino]pyrimido[4,5-c]quinoline-8-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)nc(Nc1cccc(C(F)(F)F)c1)c1nc(NC3CC3)ncc12 |
| InChI | InChI=1S/C23H18F3N5O2/c1-33-21(32)12-5-8-16-17-11-27-22(29-14-6-7-14)31-19(17)20(30-18(16)9-12)28-15-4-2-3-13(10-15)23(24,25)26/h2-5,8-11,14H,6-7H2,1H3,(H,28,30)(H,27,29,31) |
| InChIKey | YFGSHIDCHFKRSS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|