C27H39N3O4 — CID 53318285
1-(3,4,5-trimethoxyphenyl)-4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazole (PubChem CID 53318285) has the molecular formula C27H39N3O4 and a molecular weight of 469.63 g/mol. Its IUPAC name is 1-(3,4,5-trimethoxyphenyl)-4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazole.
| Compound Name | 1-(3,4,5-trimethoxyphenyl)-4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazole |
|---|---|
| PubChem CID | 53318285 |
| Molecular Formula | C27H39N3O4 |
| Molecular Weight | 469.63 g/mol |
| Exact Mass | 469.29 |
| IUPAC Name | 1-(3,4,5-trimethoxyphenyl)-4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazole |
| SMILES | COc1cc(-n2cc(COC/C=C(\C)CC/C=C(\C)CCC=C(C)C)nn2)cc(OC)c1OC |
| InChI | InChI=1S/C27H39N3O4/c1-20(2)10-8-11-21(3)12-9-13-22(4)14-15-34-19-23-18-30(29-28-23)24-16-25(31-5)27(33-7)26(17-24)32-6/h10,12,14,16-18H,8-9,11,13,15,19H2,1-7H3/b21-12+,22-14+ |
| InChIKey | AHKKRAKJEPQCSG-QRCIITMISA-N |
| XLogP | 6.23 |
| TPSA | 67.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.63 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|