C22H26N2O — CID 53318317
(3R,4S)-6-(1H-indol-7-yl)-2,2,4,7,8-pentamethyl-3,4-dihydro-1H-quinolin-3-ol (PubChem CID 53318317) has the molecular formula C22H26N2O and a molecular weight of 334.46 g/mol. Its IUPAC name is (3R,4S)-6-(1H-indol-7-yl)-2,2,4,7,8-pentamethyl-3,4-dihydro-1H-quinolin-3-ol.
| Compound Name | (3R,4S)-6-(1H-indol-7-yl)-2,2,4,7,8-pentamethyl-3,4-dihydro-1H-quinolin-3-ol |
|---|---|
| PubChem CID | 53318317 |
| Molecular Formula | C22H26N2O |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | (3R,4S)-6-(1H-indol-7-yl)-2,2,4,7,8-pentamethyl-3,4-dihydro-1H-quinolin-3-ol |
| SMILES | Cc1c(-c2cccc3cc[nH]c23)cc2c(c1C)NC(C)(C)[C@H](O)[C@H]2C |
| InChI | InChI=1S/C22H26N2O/c1-12-13(2)19-18(14(3)21(25)22(4,5)24-19)11-17(12)16-8-6-7-15-9-10-23-20(15)16/h6-11,14,21,23-25H,1-5H3/t14-,21+/m0/s1 |
| InChIKey | KXNPOCDDDALEBH-LHSJRXKWSA-N |
| XLogP | 5.12 |
| TPSA | 48.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |