C29H46O2Si — CID 53318441
(8R,9S,13S,14S,17S)-13-methyl-17-(1-tripropylsilylethenyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol (PubChem CID 53318441) has the molecular formula C29H46O2Si and a molecular weight of 454.77 g/mol. Its IUPAC name is (8R,9S,13S,14S,17S)-13-methyl-17-(1-tripropylsilylethenyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8R,9S,13S,14S,17S)-13-methyl-17-(1-tripropylsilylethenyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 53318441 |
| Molecular Formula | C29H46O2Si |
| Molecular Weight | 454.77 g/mol |
| Exact Mass | 454.33 |
| IUPAC Name | (8R,9S,13S,14S,17S)-13-methyl-17-(1-tripropylsilylethenyl)-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,17-diol |
| SMILES | C=C([C@]1(O)CC[C@H]2[C@@H]3CCc4cc(O)ccc4[C@H]3CC[C@@]21C)[Si](CCC)(CCC)CCC |
| InChI | InChI=1S/C29H46O2Si/c1-6-17-32(18-7-2,19-8-3)21(4)29(31)16-14-27-26-11-9-22-20-23(30)10-12-24(22)25(26)13-15-28(27,29)5/h10,12,20,25-27,30-31H,4,6-9,11,13-19H2,1-3,5H3/t25-,26-,27+,28+,29-/m1/s1 |
| InChIKey | ZZFABXMANOIBFV-MJXUZWQSSA-N |
| XLogP | 7.75 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.77 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|