C22H34O6 — CID 53318466
(1R,2R,3E,8Z,10R)-2-methoxy-10-(2-methoxyethoxymethoxy)-12,15,15-trimethyl-6-oxabicyclo[9.3.1]pentadeca-3,8,11-trien-5-one (PubChem CID 53318466) has the molecular formula C22H34O6 and a molecular weight of 394.51 g/mol. Its IUPAC name is (1R,2R,3E,8Z,10R)-2-methoxy-10-(2-methoxyethoxymethoxy)-12,15,15-trimethyl-6-oxabicyclo[9.3.1]pentadeca-3,8,11-trien-5-one.
| Compound Name | (1R,2R,3E,8Z,10R)-2-methoxy-10-(2-methoxyethoxymethoxy)-12,15,15-trimethyl-6-oxabicyclo[9.3.1]pentadeca-3,8,11-trien-5-one |
|---|---|
| PubChem CID | 53318466 |
| Molecular Formula | C22H34O6 |
| Molecular Weight | 394.51 g/mol |
| Exact Mass | 394.24 |
| IUPAC Name | (1R,2R,3E,8Z,10R)-2-methoxy-10-(2-methoxyethoxymethoxy)-12,15,15-trimethyl-6-oxabicyclo[9.3.1]pentadeca-3,8,11-trien-5-one |
| SMILES | COCCOCO[C@@H]1/C=C/COC(=O)/C=C\[C@@H](OC)[C@@H]2CCC(C)=C1C2(C)C |
| InChI | InChI=1S/C22H34O6/c1-16-8-9-17-18(25-5)10-11-20(23)27-12-6-7-19(21(16)22(17,2)3)28-15-26-14-13-24-4/h6-7,10-11,17-19H,8-9,12-15H2,1-5H3/b7-6+,11-10-/t17-,18+,19+/m0/s1 |
| InChIKey | KVCWSBGNYBVWSY-LPVRITJISA-N |
| XLogP | 3.43 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.51 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|