C10H15NaO13P2 — CID 53318522
sodium (3R,4S,5R)-5-[(1S)-1-carboxy-1-phosphonoethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate (PubChem CID 53318522) has the molecular formula C10H15NaO13P2 and a molecular weight of 428.16 g/mol. Its IUPAC name is sodium (3R,4S,5R)-5-[(1S)-1-carboxy-1-phosphonoethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate.
| Compound Name | sodium (3R,4S,5R)-5-[(1S)-1-carboxy-1-phosphonoethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate |
|---|---|
| PubChem CID | 53318522 |
| Molecular Formula | C10H15NaO13P2 |
| Molecular Weight | 428.16 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | sodium (3R,4S,5R)-5-[(1S)-1-carboxy-1-phosphonoethoxy]-4-hydroxy-3-phosphonooxycyclohexene-1-carboxylate |
| SMILES | C[C@@](O[C@@H]1CC(C(=O)[O-])=C[C@@H](OP(=O)(O)O)[C@H]1O)(C(=O)O)P(=O)(O)O.[Na+] |
| InChI | InChI=1S/C10H16O13P2.Na/c1-10(9(14)15,24(16,17)18)22-5-2-4(8(12)13)3-6(7(5)11)23-25(19,20)21;/h3,5-7,11H,2H2,1H3,(H,12,13)(H,14,15)(H2,16,17,18)(H2,19,20,21);/q;+1/p-1/t5-,6-,7+,10+;/m1./s1 |
| InChIKey | UWCJBFWMEUUSAP-OFVDGKJZSA-M |
| XLogP | -5.73 |
| TPSA | 231.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.16 |
| LogP ≤ 5 | -5.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|