C34H45F9O4 — CID 53318530
10-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid (PubChem CID 53318530) has the molecular formula C34H45F9O4 and a molecular weight of 688.71 g/mol. Its IUPAC name is 10-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid.
| Compound Name | 10-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid |
|---|---|
| PubChem CID | 53318530 |
| Molecular Formula | C34H45F9O4 |
| Molecular Weight | 688.71 g/mol |
| Exact Mass | 688.32 |
| IUPAC Name | 10-[(7R,8R,9S,13S,14S,17S)-3,17-dihydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-7-yl]-2-(3,3,4,4,5,5,6,6,6-nonafluorohexyl)decanoic acid |
| SMILES | C[C@]12CC[C@@H]3c4ccc(O)cc4C[C@@H](CCCCCCCCC(CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)C(=O)O)[C@H]3[C@@H]1CC[C@@H]2O |
| InChI | InChI=1S/C34H45F9O4/c1-30-16-15-25-24-11-10-23(44)19-22(24)18-21(28(25)26(30)12-13-27(30)45)9-7-5-3-2-4-6-8-20(29(46)47)14-17-31(35,36)32(37,38)33(39,40)34(41,42)43/h10-11,19-21,25-28,44-45H,2-9,12-18H2,1H3,(H,46,47)/t20?,21-,25-,26+,27+,28-,30+/m1/s1 |
| InChIKey | JDZWFSIFQRMXQN-CKZFDKJMSA-N |
| XLogP | 9.91 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.71 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|