C25H30O — CID 53318533
(8S,9S,13S,14S,17S)-3-methoxy-13-methyl-17-phenyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene (PubChem CID 53318533) has the molecular formula C25H30O and a molecular weight of 346.51 g/mol. Its IUPAC name is (8S,9S,13S,14S,17S)-3-methoxy-13-methyl-17-phenyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,13S,14S,17S)-3-methoxy-13-methyl-17-phenyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 53318533 |
| Molecular Formula | C25H30O |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (8S,9S,13S,14S,17S)-3-methoxy-13-methyl-17-phenyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene |
| SMILES | COc1ccc2c(c1)CC[C@@H]1[C@@H]2CC[C@]2(C)[C@@H](c3ccccc3)CC[C@@H]12 |
| InChI | InChI=1S/C25H30O/c1-25-15-14-21-20-11-9-19(26-2)16-18(20)8-10-22(21)24(25)13-12-23(25)17-6-4-3-5-7-17/h3-7,9,11,16,21-24H,8,10,12-15H2,1-2H3/t21-,22-,23-,24+,25-/m1/s1 |
| InChIKey | RDNUFPFDKVBGIK-UUFXTFJOSA-N |
| XLogP | 6.34 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |