C25H38O3 — CID 53318580
(8S,9S,11S,13S,14S,17S)-13-methyl-11-[3-[(2-methylpropan-2-yl)oxy]propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 53318580) has the molecular formula C25H38O3 and a molecular weight of 386.58 g/mol. Its IUPAC name is (8S,9S,11S,13S,14S,17S)-13-methyl-11-[3-[(2-methylpropan-2-yl)oxy]propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,11S,13S,14S,17S)-13-methyl-11-[3-[(2-methylpropan-2-yl)oxy]propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 53318580 |
| Molecular Formula | C25H38O3 |
| Molecular Weight | 386.58 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | (8S,9S,11S,13S,14S,17S)-13-methyl-11-[3-[(2-methylpropan-2-yl)oxy]propyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC(C)(C)OCCC[C@H]1C[C@]2(C)[C@@H](O)CC[C@H]2[C@@H]2CCc3cc(O)ccc3[C@@H]12 |
| InChI | InChI=1S/C25H38O3/c1-24(2,3)28-13-5-6-17-15-25(4)21(11-12-22(25)27)20-9-7-16-14-18(26)8-10-19(16)23(17)20/h8,10,14,17,20-23,26-27H,5-7,9,11-13,15H2,1-4H3/t17-,20-,21-,22-,23+,25-/m0/s1 |
| InChIKey | QBVDFBVTDVWGKH-OBGHYYFISA-N |
| XLogP | 5.43 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.58 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|