About 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one
7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one (PubChem CID 53318642) has the molecular formula C19H17ClN4O
and a molecular weight of 352.83 g/mol. Its IUPAC name is 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one.
Molecular Properties
| Compound Name | 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one |
| PubChem CID | 53318642 |
| Molecular Formula | C19H17ClN4O |
| Molecular Weight | 352.83 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one |
| SMILES | CCn1cc2c(n1)N(C)c1ccc(Cl)cc1N(c1ccccc1)C2=O |
| InChI | InChI=1S/C19H17ClN4O/c1-3-23-12-15-18(21-23)22(2)16-10-9-13(20)11-17(16)24(19(15)25)14-7-5-4-6-8-14/h4-12H,3H2,1-2H3 |
| InChIKey | VVPIBKSVJBQHDY-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.83 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one?
The IUPAC name of 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one (CID 53318642) is 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one.
What is the SMILES notation for 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one?
The canonical SMILES for 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one is CCn1cc2c(n1)N(C)c1ccc(Cl)cc1N(c1ccccc1)C2=O.
What is the InChIKey of 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one?
The InChIKey is VVPIBKSVJBQHDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17ClN4O/c1-3-23-12-15-18(21-23)22(2)16-10-9-13(20)11-17(16)24(19(15)25)14-7-5-4-6-8-14/h4-12H,3H2,1-2H3.
What are the key properties of 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one?
7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one has a molecular weight of 352.83 g/mol, XLogP of 4.62, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-2-ethyl-10-methyl-5-phenylpyrazolo[3,4-b][1,5]benzodiazepin-4-one is sourced from PubChem (CID 53318642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).