C13H22O5 — CID 53318667
ethyl 2-[(1R,2R,5S,6S)-5-pentyl-3,4,7-trioxabicyclo[4.1.0]heptan-2-yl]acetate (PubChem CID 53318667) has the molecular formula C13H22O5 and a molecular weight of 258.31 g/mol. Its IUPAC name is ethyl 2-[(1R,2R,5S,6S)-5-pentyl-3,4,7-trioxabicyclo[4.1.0]heptan-2-yl]acetate.
| Compound Name | ethyl 2-[(1R,2R,5S,6S)-5-pentyl-3,4,7-trioxabicyclo[4.1.0]heptan-2-yl]acetate |
|---|---|
| PubChem CID | 53318667 |
| Molecular Formula | C13H22O5 |
| Molecular Weight | 258.31 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | ethyl 2-[(1R,2R,5S,6S)-5-pentyl-3,4,7-trioxabicyclo[4.1.0]heptan-2-yl]acetate |
| SMILES | CCCCC[C@@H]1OO[C@H](CC(=O)OCC)[C@@H]2O[C@@H]21 |
| InChI | InChI=1S/C13H22O5/c1-3-5-6-7-9-12-13(16-12)10(18-17-9)8-11(14)15-4-2/h9-10,12-13H,3-8H2,1-2H3/t9-,10+,12+,13-/m0/s1 |
| InChIKey | HIVLLLCMDGBGTC-YGNMPJRFSA-N |
| XLogP | 1.99 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.31 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|