C22H21ClFNO5S — CID 53318726
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53318726) has the molecular formula C22H21ClFNO5S and a molecular weight of 465.93 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53318726 |
| Molecular Formula | C22H21ClFNO5S |
| Molecular Weight | 465.93 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[[5-(4-fluorophenyl)-1,3-thiazol-2-yl]methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(-c4ccc(F)cc4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H21ClFNO5S/c23-15-6-3-12(22-21(29)20(28)19(27)16(10-26)30-22)7-13(15)8-18-25-9-17(31-18)11-1-4-14(24)5-2-11/h1-7,9,16,19-22,26-29H,8,10H2/t16-,19-,20+,21-,22+/m1/s1 |
| InChIKey | RMQIOFCXWNKZEV-OSKXVONFSA-N |
| XLogP | 2.71 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.93 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |