C25H35N3O2 — CID 53318797
1-(3-methoxyphenyl)-4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazole (PubChem CID 53318797) has the molecular formula C25H35N3O2 and a molecular weight of 409.57 g/mol. Its IUPAC name is 1-(3-methoxyphenyl)-4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazole.
| Compound Name | 1-(3-methoxyphenyl)-4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazole |
|---|---|
| PubChem CID | 53318797 |
| Molecular Formula | C25H35N3O2 |
| Molecular Weight | 409.57 g/mol |
| Exact Mass | 409.27 |
| IUPAC Name | 1-(3-methoxyphenyl)-4-[[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]methyl]triazole |
| SMILES | COc1cccc(-n2cc(COC/C=C(\C)CC/C=C(\C)CCC=C(C)C)nn2)c1 |
| InChI | InChI=1S/C25H35N3O2/c1-20(2)9-6-10-21(3)11-7-12-22(4)15-16-30-19-23-18-28(27-26-23)24-13-8-14-25(17-24)29-5/h8-9,11,13-15,17-18H,6-7,10,12,16,19H2,1-5H3/b21-11+,22-15+ |
| InChIKey | IOIVNXANUBYNRC-XQOFNESLSA-N |
| XLogP | 6.21 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.57 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|