About (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine
(1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine (PubChem CID 53318865) has the molecular formula C18H20F3N3
and a molecular weight of 335.37 g/mol. Its IUPAC name is (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine.
Molecular Properties
| Compound Name | (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine |
| PubChem CID | 53318865 |
| Molecular Formula | C18H20F3N3 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.16 |
| IUPAC Name | (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine |
| SMILES | N[C@H](Cc1cc(F)ccc1F)C1CCN(c2ccc(F)nc2)CC1 |
| InChI | InChI=1S/C18H20F3N3/c19-14-1-3-16(20)13(9-14)10-17(22)12-5-7-24(8-6-12)15-2-4-18(21)23-11-15/h1-4,9,11-12,17H,5-8,10,22H2/t17-/m1/s1 |
| InChIKey | QQVUXENLUIUCMJ-QGZVFWFLSA-N |
| XLogP | 3.29 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine?
The IUPAC name of (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine (CID 53318865) is (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine.
What is the SMILES notation for (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine?
The canonical SMILES for (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine is N[C@H](Cc1cc(F)ccc1F)C1CCN(c2ccc(F)nc2)CC1.
What is the InChIKey of (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine?
The InChIKey is QQVUXENLUIUCMJ-QGZVFWFLSA-N. The full InChI is InChI=1S/C18H20F3N3/c19-14-1-3-16(20)13(9-14)10-17(22)12-5-7-24(8-6-12)15-2-4-18(21)23-11-15/h1-4,9,11-12,17H,5-8,10,22H2/t17-/m1/s1.
What are the key properties of (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine?
(1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine has a molecular weight of 335.37 g/mol, XLogP of 3.29, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-2-(2,5-difluorophenyl)-1-[1-(6-fluoro-3-pyridinyl)piperidin-4-yl]ethanamine is sourced from PubChem (CID 53318865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).