C19H28N2O2 — CID 53319145
2-nitro-4-[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-pyrrole (PubChem CID 53319145) has the molecular formula C19H28N2O2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-nitro-4-[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-pyrrole.
| Compound Name | 2-nitro-4-[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-pyrrole |
|---|---|
| PubChem CID | 53319145 |
| Molecular Formula | C19H28N2O2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.22 |
| IUPAC Name | 2-nitro-4-[(2Z,6Z)-3,7,11-trimethyldodeca-2,6,10-trienyl]-1H-pyrrole |
| SMILES | CC(C)=CCC/C(C)=C\CC/C(C)=C\Cc1c[nH]c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H28N2O2/c1-15(2)7-5-8-16(3)9-6-10-17(4)11-12-18-13-19(20-14-18)21(22)23/h7,9,11,13-14,20H,5-6,8,10,12H2,1-4H3/b16-9-,17-11- |
| InChIKey | SDKSFPZFFMRPPX-GESPRJTDSA-N |
| XLogP | 5.88 |
| TPSA | 58.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|