C14H15FO4S — CID 53319212
(2E,4E)-6-(4-fluorophenyl)sulfonyl-4-methylhepta-2,4-dienoic acid (PubChem CID 53319212) has the molecular formula C14H15FO4S and a molecular weight of 298.34 g/mol. Its IUPAC name is (2E,4E)-6-(4-fluorophenyl)sulfonyl-4-methylhepta-2,4-dienoic acid.
| Compound Name | (2E,4E)-6-(4-fluorophenyl)sulfonyl-4-methylhepta-2,4-dienoic acid |
|---|---|
| PubChem CID | 53319212 |
| Molecular Formula | C14H15FO4S |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | (2E,4E)-6-(4-fluorophenyl)sulfonyl-4-methylhepta-2,4-dienoic acid |
| SMILES | CC(/C=C/C(=O)O)=C\C(C)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FO4S/c1-10(3-8-14(16)17)9-11(2)20(18,19)13-6-4-12(15)5-7-13/h3-9,11H,1-2H3,(H,16,17)/b8-3+,10-9+ |
| InChIKey | LXBQJYOZXKVJCX-YELSXNLMSA-N |
| XLogP | 2.58 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|