C15H19NO4S — CID 53319213
(2E,4E)-N-hydroxy-4-methyl-6-(4-methylphenyl)sulfonylhepta-2,4-dienamide (PubChem CID 53319213) has the molecular formula C15H19NO4S and a molecular weight of 309.39 g/mol. Its IUPAC name is (2E,4E)-N-hydroxy-4-methyl-6-(4-methylphenyl)sulfonylhepta-2,4-dienamide.
| Compound Name | (2E,4E)-N-hydroxy-4-methyl-6-(4-methylphenyl)sulfonylhepta-2,4-dienamide |
|---|---|
| PubChem CID | 53319213 |
| Molecular Formula | C15H19NO4S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (2E,4E)-N-hydroxy-4-methyl-6-(4-methylphenyl)sulfonylhepta-2,4-dienamide |
| SMILES | CC(/C=C/C(=O)NO)=C\C(C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H19NO4S/c1-11-4-7-14(8-5-11)21(19,20)13(3)10-12(2)6-9-15(17)16-18/h4-10,13,18H,1-3H3,(H,16,17)/b9-6+,12-10+ |
| InChIKey | JUBNSJKTRSAWBY-LWGDNYCUSA-N |
| XLogP | 2.17 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|