About 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile
3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile (PubChem CID 53319299) has the molecular formula C10H10BNO2
and a molecular weight of 187.01 g/mol. Its IUPAC name is 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile.
Molecular Properties
| Compound Name | 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile |
| PubChem CID | 53319299 |
| Molecular Formula | C10H10BNO2 |
| Molecular Weight | 187.01 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile |
| SMILES | N#CCCc1cccc2c1B(O)OC2 |
| InChI | InChI=1S/C10H10BNO2/c12-6-2-5-8-3-1-4-9-7-14-11(13)10(8)9/h1,3-4,13H,2,5,7H2 |
| InChIKey | HCKXQLAFFRDJEG-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 53.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.01 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile?
The IUPAC name of 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile (CID 53319299) is 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile.
What is the SMILES notation for 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile?
The canonical SMILES for 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile is N#CCCc1cccc2c1B(O)OC2.
What is the InChIKey of 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile?
The InChIKey is HCKXQLAFFRDJEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BNO2/c12-6-2-5-8-3-1-4-9-7-14-11(13)10(8)9/h1,3-4,13H,2,5,7H2.
What are the key properties of 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile?
3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile has a molecular weight of 187.01 g/mol, XLogP of 0.36, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)propanenitrile is sourced from PubChem (CID 53319299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).