C26H26F3N5O — CID 53319366
3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-[(1R)-1-(3,4,5-trifluorophenyl)propyl]-2,4,5,6-tetrahydropyrazolo[3,4-b]pyridine (PubChem CID 53319366) has the molecular formula C26H26F3N5O and a molecular weight of 481.52 g/mol. Its IUPAC name is 3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-[(1R)-1-(3,4,5-trifluorophenyl)propyl]-2,4,5,6-tetrahydropyrazolo[3,4-b]pyridine.
| Compound Name | 3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-[(1R)-1-(3,4,5-trifluorophenyl)propyl]-2,4,5,6-tetrahydropyrazolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 53319366 |
| Molecular Formula | C26H26F3N5O |
| Molecular Weight | 481.52 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 3-[3-methoxy-4-(4-methylimidazol-1-yl)phenyl]-7-[(1R)-1-(3,4,5-trifluorophenyl)propyl]-2,4,5,6-tetrahydropyrazolo[3,4-b]pyridine |
| SMILES | CC[C@H](c1cc(F)c(F)c(F)c1)N1CCCc2c1n[nH]c2-c1ccc(-n2cnc(C)c2)c(OC)c1 |
| InChI | InChI=1S/C26H26F3N5O/c1-4-21(17-10-19(27)24(29)20(28)11-17)34-9-5-6-18-25(31-32-26(18)34)16-7-8-22(23(12-16)35-3)33-13-15(2)30-14-33/h7-8,10-14,21H,4-6,9H2,1-3H3,(H,31,32)/t21-/m1/s1 |
| InChIKey | RYBOOAKEZKQWGG-OAQYLSRUSA-N |
| XLogP | 5.90 |
| TPSA | 58.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.52 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|