About 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol
3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol (PubChem CID 53319383) has the molecular formula C16H18N6O4S
and a molecular weight of 390.43 g/mol. Its IUPAC name is 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol.
Molecular Properties
| Compound Name | 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol |
| PubChem CID | 53319383 |
| Molecular Formula | C16H18N6O4S |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.11 |
| IUPAC Name | 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol |
| SMILES | CS(=O)(=O)N1CCC(n2cc(-c3nnc(-c4cccc(O)c4)o3)nn2)CC1 |
| InChI | InChI=1S/C16H18N6O4S/c1-27(24,25)21-7-5-12(6-8-21)22-10-14(17-20-22)16-19-18-15(26-16)11-3-2-4-13(23)9-11/h2-4,9-10,12,23H,5-8H2,1H3 |
| InChIKey | UUWGTFKPKKAJIT-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol?
The IUPAC name of 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol (CID 53319383) is 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol.
What is the SMILES notation for 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol?
The canonical SMILES for 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol is CS(=O)(=O)N1CCC(n2cc(-c3nnc(-c4cccc(O)c4)o3)nn2)CC1.
What is the InChIKey of 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol?
The InChIKey is UUWGTFKPKKAJIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N6O4S/c1-27(24,25)21-7-5-12(6-8-21)22-10-14(17-20-22)16-19-18-15(26-16)11-3-2-4-13(23)9-11/h2-4,9-10,12,23H,5-8H2,1H3.
What are the key properties of 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol?
3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol has a molecular weight of 390.43 g/mol, XLogP of 1.30, 4 rotatable bonds, 1 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-[1-(1-methylsulfonylpiperidin-4-yl)triazol-4-yl]-1,3,4-oxadiazol-2-yl]phenol is sourced from PubChem (CID 53319383), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).