C26H28N2O5 — CID 53319539
N-[[3-(4-methoxyoxan-4-yl)phenyl]methyl]-4-nitro-2-phenylmethoxyaniline (PubChem CID 53319539) has the molecular formula C26H28N2O5 and a molecular weight of 448.52 g/mol. Its IUPAC name is N-[[3-(4-methoxyoxan-4-yl)phenyl]methyl]-4-nitro-2-phenylmethoxyaniline.
| Compound Name | N-[[3-(4-methoxyoxan-4-yl)phenyl]methyl]-4-nitro-2-phenylmethoxyaniline |
|---|---|
| PubChem CID | 53319539 |
| Molecular Formula | C26H28N2O5 |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.20 |
| IUPAC Name | N-[[3-(4-methoxyoxan-4-yl)phenyl]methyl]-4-nitro-2-phenylmethoxyaniline |
| SMILES | COC1(c2cccc(CNc3ccc([N+](=O)[O-])cc3OCc3ccccc3)c2)CCOCC1 |
| InChI | InChI=1S/C26H28N2O5/c1-31-26(12-14-32-15-13-26)22-9-5-8-21(16-22)18-27-24-11-10-23(28(29)30)17-25(24)33-19-20-6-3-2-4-7-20/h2-11,16-17,27H,12-15,18-19H2,1H3 |
| InChIKey | FHXVUPSSYZRGCU-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|