About 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole
4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole (PubChem CID 53319649) has the molecular formula C20H27N3O2
and a molecular weight of 341.46 g/mol. Its IUPAC name is 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole.
Molecular Properties
| Compound Name | 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole |
| PubChem CID | 53319649 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.46 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole |
| SMILES | COc1cccc(-n2cc(COC/C=C(\C)CCC=C(C)C)nn2)c1 |
| InChI | InChI=1S/C20H27N3O2/c1-16(2)7-5-8-17(3)11-12-25-15-18-14-23(22-21-18)19-9-6-10-20(13-19)24-4/h6-7,9-11,13-14H,5,8,12,15H2,1-4H3/b17-11+ |
| InChIKey | XCPQNWDCNUOCSA-GZTJUZNOSA-N |
| XLogP | 4.49 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.46 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole?
The IUPAC name of 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole (CID 53319649) is 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole.
What is the SMILES notation for 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole?
The canonical SMILES for 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole is COc1cccc(-n2cc(COC/C=C(\C)CCC=C(C)C)nn2)c1.
What is the InChIKey of 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole?
The InChIKey is XCPQNWDCNUOCSA-GZTJUZNOSA-N. The full InChI is InChI=1S/C20H27N3O2/c1-16(2)7-5-8-17(3)11-12-25-15-18-14-23(22-21-18)19-9-6-10-20(13-19)24-4/h6-7,9-11,13-14H,5,8,12,15H2,1-4H3/b17-11+.
What are the key properties of 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole?
4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole has a molecular weight of 341.46 g/mol, XLogP of 4.49, 9 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(2E)-3,7-dimethylocta-2,6-dienoxy]methyl]-1-(3-methoxyphenyl)triazole is sourced from PubChem (CID 53319649), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).