About 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate
5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate (PubChem CID 53319814) has the molecular formula C17H12F3NO4S2
and a molecular weight of 415.41 g/mol. Its IUPAC name is 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate |
| PubChem CID | 53319814 |
| Molecular Formula | C17H12F3NO4S2 |
| Molecular Weight | 415.41 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate |
| SMILES | C[n+]1c2cccc(O)c2cc2sc3ccccc3c21.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C16H11NOS.CHF3O3S/c1-17-12-6-4-7-13(18)11(12)9-15-16(17)10-5-2-3-8-14(10)19-15;2-1(3,4)8(5,6)7/h2-9H,1H3;(H,5,6,7) |
| InChIKey | UGJLOYJJVFYDAH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate?
The IUPAC name of 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate (CID 53319814) is 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate.
What is the SMILES notation for 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate?
The canonical SMILES for 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate is C[n+]1c2cccc(O)c2cc2sc3ccccc3c21.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate?
The InChIKey is UGJLOYJJVFYDAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11NOS.CHF3O3S/c1-17-12-6-4-7-13(18)11(12)9-15-16(17)10-5-2-3-8-14(10)19-15;2-1(3,4)8(5,6)7/h2-9H,1H3;(H,5,6,7).
What are the key properties of 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate?
5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate has a molecular weight of 415.41 g/mol, XLogP of 3.79, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-[1]benzothiolo[3,2-b]quinolin-5-ium-1-ol;trifluoromethanesulfonate is sourced from PubChem (CID 53319814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).