C24H36O3 — CID 53319904
(8S,9S,11R,13S,14S,17S)-13-methyl-11-[2-[(2-methylpropan-2-yl)oxy]ethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol (PubChem CID 53319904) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is (8S,9S,11R,13S,14S,17S)-13-methyl-11-[2-[(2-methylpropan-2-yl)oxy]ethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol.
| Compound Name | (8S,9S,11R,13S,14S,17S)-13-methyl-11-[2-[(2-methylpropan-2-yl)oxy]ethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
|---|---|
| PubChem CID | 53319904 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | (8S,9S,11R,13S,14S,17S)-13-methyl-11-[2-[(2-methylpropan-2-yl)oxy]ethyl]-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthrene-3,17-diol |
| SMILES | CC(C)(C)OCC[C@H]1C[C@]2(C)[C@@H](O)CC[C@H]2[C@@H]2CCc3cc(O)ccc3[C@@H]12 |
| InChI | InChI=1S/C24H36O3/c1-23(2,3)27-12-11-16-14-24(4)20(9-10-21(24)26)19-7-5-15-13-17(25)6-8-18(15)22(16)19/h6,8,13,16,19-22,25-26H,5,7,9-12,14H2,1-4H3/t16-,19-,20-,21-,22+,24-/m0/s1 |
| InChIKey | OREHEHBDBIRYRU-KOZSAJOLSA-N |
| XLogP | 5.04 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |