C26H31ClN6O4 — CID 53319963
5-chloro-2-N,4-N-bis(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine (PubChem CID 53319963) has the molecular formula C26H31ClN6O4 and a molecular weight of 527.03 g/mol. Its IUPAC name is 5-chloro-2-N,4-N-bis(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine.
| Compound Name | 5-chloro-2-N,4-N-bis(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 53319963 |
| Molecular Formula | C26H31ClN6O4 |
| Molecular Weight | 527.03 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | 5-chloro-2-N,4-N-bis(2-methoxy-4-morpholin-4-ylphenyl)pyrimidine-2,4-diamine |
| SMILES | COc1cc(N2CCOCC2)ccc1Nc1ncc(Cl)c(Nc2ccc(N3CCOCC3)cc2OC)n1 |
| InChI | InChI=1S/C26H31ClN6O4/c1-34-23-15-18(32-7-11-36-12-8-32)3-5-21(23)29-25-20(27)17-28-26(31-25)30-22-6-4-19(16-24(22)35-2)33-9-13-37-14-10-33/h3-6,15-17H,7-14H2,1-2H3,(H2,28,29,30,31) |
| InChIKey | DNVHYSBDUBOLFU-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.03 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |