C22H28ClNO5S — CID 53320039
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-cyclohexyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53320039) has the molecular formula C22H28ClNO5S and a molecular weight of 453.99 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-cyclohexyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-cyclohexyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53320039 |
| Molecular Formula | C22H28ClNO5S |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-cyclohexyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](c2ccc(Cl)c(Cc3ncc(C4CCCCC4)s3)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H28ClNO5S/c23-15-7-6-13(22-21(28)20(27)19(26)16(11-25)29-22)8-14(15)9-18-24-10-17(30-18)12-4-2-1-3-5-12/h6-8,10,12,16,19-22,25-28H,1-5,9,11H2/t16-,19-,20+,21-,22+/m1/s1 |
| InChIKey | HEFPDGCKBMYHFH-OSKXVONFSA-N |
| XLogP | 2.95 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |