C19H24ClNO5S2 — CID 53320041
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-propylsulfanyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53320041) has the molecular formula C19H24ClNO5S2 and a molecular weight of 445.99 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-propylsulfanyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-propylsulfanyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53320041 |
| Molecular Formula | C19H24ClNO5S2 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.08 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-propylsulfanyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCSc1cnc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)C3O)ccc2Cl)s1 |
| InChI | InChI=1S/C19H24ClNO5S2/c1-2-5-27-15-8-21-14(28-15)7-11-6-10(3-4-12(11)20)19-18(25)17(24)16(23)13(9-22)26-19/h3-4,6,8,13,16-19,22-25H,2,5,7,9H2,1H3/t13-,16-,17+,18?,19+/m1/s1 |
| InChIKey | FAHJEBQCCSGNCC-ANLHIERVSA-N |
| XLogP | 2.40 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |