C21H28ClNO5S2 — CID 53320042
(2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-pentylsulfanyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol (PubChem CID 53320042) has the molecular formula C21H28ClNO5S2 and a molecular weight of 474.04 g/mol. Its IUPAC name is (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-pentylsulfanyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-pentylsulfanyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53320042 |
| Molecular Formula | C21H28ClNO5S2 |
| Molecular Weight | 474.04 g/mol |
| Exact Mass | 473.11 |
| IUPAC Name | (2S,3R,4R,5S,6R)-2-[4-chloro-3-[(5-pentylsulfanyl-1,3-thiazol-2-yl)methyl]phenyl]-6-(hydroxymethyl)oxane-3,4,5-triol |
| SMILES | CCCCCSc1cnc(Cc2cc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)C3O)ccc2Cl)s1 |
| InChI | InChI=1S/C21H28ClNO5S2/c1-2-3-4-7-29-17-10-23-16(30-17)9-13-8-12(5-6-14(13)22)21-20(27)19(26)18(25)15(11-24)28-21/h5-6,8,10,15,18-21,24-27H,2-4,7,9,11H2,1H3/t15-,18-,19+,20?,21+/m1/s1 |
| InChIKey | QDMONWYACIIUKC-DXEDAVMJSA-N |
| XLogP | 3.18 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.04 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|