C21H23NO5S2 — CID 53320044
(2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]oxane-3,4,5-triol (PubChem CID 53320044) has the molecular formula C21H23NO5S2 and a molecular weight of 433.55 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 53320044 |
| Molecular Formula | C21H23NO5S2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-(hydroxymethyl)-6-[4-methyl-3-[(5-thiophen-3-yl-1,3-thiazol-2-yl)methyl]phenyl]oxane-3,4,5-triol |
| SMILES | Cc1ccc([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)cc1Cc1ncc(-c2ccsc2)s1 |
| InChI | InChI=1S/C21H23NO5S2/c1-11-2-3-12(21-20(26)19(25)18(24)15(9-23)27-21)6-14(11)7-17-22-8-16(29-17)13-4-5-28-10-13/h2-6,8,10,15,18-21,23-26H,7,9H2,1H3/t15-,18-,19+,20-,21+/m1/s1 |
| InChIKey | VPRBIMRNMNMIMA-GRARQNNCSA-N |
| XLogP | 2.29 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |