About N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide
N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide (PubChem CID 53320181) has the molecular formula C18H26F2N2O
and a molecular weight of 324.42 g/mol. Its IUPAC name is N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide.
Molecular Properties
| Compound Name | N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide |
| PubChem CID | 53320181 |
| Molecular Formula | C18H26F2N2O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide |
| SMILES | CCN(C(C)=O)C1CCC([C@H](N)Cc2cc(F)ccc2F)CC1 |
| InChI | InChI=1S/C18H26F2N2O/c1-3-22(12(2)23)16-7-4-13(5-8-16)18(21)11-14-10-15(19)6-9-17(14)20/h6,9-10,13,16,18H,3-5,7-8,11,21H2,1-2H3/t13?,16?,18-/m1/s1 |
| InChIKey | HBNPZSOWWHBCOH-PVCYVWKFSA-N |
| XLogP | 3.26 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide?
The IUPAC name of N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide (CID 53320181) is N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide.
What is the SMILES notation for N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide?
The canonical SMILES for N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide is CCN(C(C)=O)C1CCC([C@H](N)Cc2cc(F)ccc2F)CC1.
What is the InChIKey of N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide?
The InChIKey is HBNPZSOWWHBCOH-PVCYVWKFSA-N. The full InChI is InChI=1S/C18H26F2N2O/c1-3-22(12(2)23)16-7-4-13(5-8-16)18(21)11-14-10-15(19)6-9-17(14)20/h6,9-10,13,16,18H,3-5,7-8,11,21H2,1-2H3/t13?,16?,18-/m1/s1.
What are the key properties of N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide?
N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide has a molecular weight of 324.42 g/mol, XLogP of 3.26, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[(1R)-1-amino-2-(2,5-difluorophenyl)ethyl]cyclohexyl]-N-ethylacetamide is sourced from PubChem (CID 53320181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).