C19H34F5NO — CID 533202
N,N-bis(2-ethylhexyl)-2,2,3,3,3-pentafluoropropanamide (PubChem CID 533202) has the molecular formula C19H34F5NO and a molecular weight of 387.48 g/mol. Its IUPAC name is N,N-bis(2-ethylhexyl)-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N,N-bis(2-ethylhexyl)-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 533202 |
| Molecular Formula | C19H34F5NO |
| Molecular Weight | 387.48 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | N,N-bis(2-ethylhexyl)-2,2,3,3,3-pentafluoropropanamide |
| SMILES | CCCCC(CC)CN(CC(CC)CCCC)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C19H34F5NO/c1-5-9-11-15(7-3)13-25(14-16(8-4)12-10-6-2)17(26)18(20,21)19(22,23)24/h15-16H,5-14H2,1-4H3 |
| InChIKey | DDIQDKUPDGNIMH-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.48 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|