About tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate
tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate (PubChem CID 53320210) has the molecular formula C23H39N3O2
and a molecular weight of 389.58 g/mol. Its IUPAC name is tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate.
Molecular Properties
| Compound Name | tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate |
| PubChem CID | 53320210 |
| Molecular Formula | C23H39N3O2 |
| Molecular Weight | 389.58 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCCCNC1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C23H39N3O2/c1-23(2,3)28-22(27)25-16-9-5-8-15-24-21-13-18-26(19-14-21)17-12-20-10-6-4-7-11-20/h4,6-7,10-11,21,24H,5,8-9,12-19H2,1-3H3,(H,25,27) |
| InChIKey | VUIVPMSUEYWPBF-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.58 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate?
The IUPAC name of tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate (CID 53320210) is tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate.
What is the SMILES notation for tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate?
The canonical SMILES for tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate is CC(C)(C)OC(=O)NCCCCCNC1CCN(CCc2ccccc2)CC1.
What is the InChIKey of tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate?
The InChIKey is VUIVPMSUEYWPBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H39N3O2/c1-23(2,3)28-22(27)25-16-9-5-8-15-24-21-13-18-26(19-14-21)17-12-20-10-6-4-7-11-20/h4,6-7,10-11,21,24H,5,8-9,12-19H2,1-3H3,(H,25,27).
What are the key properties of tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate?
tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate has a molecular weight of 389.58 g/mol, XLogP of 3.98, 10 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[5-[[1-(2-phenylethyl)piperidin-4-yl]amino]pentyl]carbamate is sourced from PubChem (CID 53320210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).