About 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate
2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate (PubChem CID 53320275) has the molecular formula C18H14Cl3NO3S
and a molecular weight of 430.74 g/mol. Its IUPAC name is 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate.
Molecular Properties
| Compound Name | 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate |
| PubChem CID | 53320275 |
| Molecular Formula | C18H14Cl3NO3S |
| Molecular Weight | 430.74 g/mol |
| Exact Mass | 428.98 |
| IUPAC Name | 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCc1c(Cl)nc2ccc(Cl)cc2c1-c1ccccc1Cl |
| InChI | InChI=1S/C18H14Cl3NO3S/c1-26(23,24)25-9-8-13-17(12-4-2-3-5-15(12)20)14-10-11(19)6-7-16(14)22-18(13)21/h2-7,10H,8-9H2,1H3 |
| InChIKey | YNYGEAIDLGXWTM-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 430.74 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate?
The IUPAC name of 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate (CID 53320275) is 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate.
What is the SMILES notation for 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate?
The canonical SMILES for 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate is CS(=O)(=O)OCCc1c(Cl)nc2ccc(Cl)cc2c1-c1ccccc1Cl.
What is the InChIKey of 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate?
The InChIKey is YNYGEAIDLGXWTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14Cl3NO3S/c1-26(23,24)25-9-8-13-17(12-4-2-3-5-15(12)20)14-10-11(19)6-7-16(14)22-18(13)21/h2-7,10H,8-9H2,1H3.
What are the key properties of 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate?
2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate has a molecular weight of 430.74 g/mol, XLogP of 5.38, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-dichloro-4-(2-chlorophenyl)quinolin-3-yl]ethyl methanesulfonate is sourced from PubChem (CID 53320275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).