C19H18N4O2S — CID 53320305
3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide (PubChem CID 53320305) has the molecular formula C19H18N4O2S and a molecular weight of 366.45 g/mol. Its IUPAC name is 3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide.
| Compound Name | 3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 53320305 |
| Molecular Formula | C19H18N4O2S |
| Molecular Weight | 366.45 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | 3-[[(1Z)-1-hydroxyimino-2,3-dihydroinden-5-yl]amino]-N,N-dimethylthieno[2,3-c]pyridine-2-carboxamide |
| SMILES | CN(C)C(=O)c1sc2cnccc2c1Nc1ccc2c(c1)CC/C2=N/O |
| InChI | InChI=1S/C19H18N4O2S/c1-23(2)19(24)18-17(14-7-8-20-10-16(14)26-18)21-12-4-5-13-11(9-12)3-6-15(13)22-25/h4-5,7-10,21,25H,3,6H2,1-2H3/b22-15- |
| InChIKey | KQAVXLJLCOYDRL-JCMHNJIXSA-N |
| XLogP | 3.87 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.45 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|