C25H29N7O — CID 53320393
5,11-dimethyl-2-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one (PubChem CID 53320393) has the molecular formula C25H29N7O and a molecular weight of 443.56 g/mol. Its IUPAC name is 5,11-dimethyl-2-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one.
| Compound Name | 5,11-dimethyl-2-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 53320393 |
| Molecular Formula | C25H29N7O |
| Molecular Weight | 443.56 g/mol |
| Exact Mass | 443.24 |
| IUPAC Name | 5,11-dimethyl-2-[2-methyl-4-(4-methylpiperazin-1-yl)anilino]pyrimido[4,5-b][1,4]benzodiazepin-6-one |
| SMILES | Cc1cc(N2CCN(C)CC2)ccc1Nc1ncc2c(n1)N(C)c1ccccc1C(=O)N2C |
| InChI | InChI=1S/C25H29N7O/c1-17-15-18(32-13-11-29(2)12-14-32)9-10-20(17)27-25-26-16-22-23(28-25)30(3)21-8-6-5-7-19(21)24(33)31(22)4/h5-10,15-16H,11-14H2,1-4H3,(H,26,27,28) |
| InChIKey | DDFSQXFBHZHGHD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|