C22H30Br2N6O — CID 53320403
1-[(E)-[4-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methoxy]phenyl]methylideneamino]-2,3-diethylguanidine;bromide;hydrobromide (PubChem CID 53320403) has the molecular formula C22H30Br2N6O and a molecular weight of 554.33 g/mol. Its IUPAC name is 1-[(E)-[4-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methoxy]phenyl]methylideneamino]-2,3-diethylguanidine;bromide;hydrobromide.
| Compound Name | 1-[(E)-[4-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methoxy]phenyl]methylideneamino]-2,3-diethylguanidine;bromide;hydrobromide |
|---|---|
| PubChem CID | 53320403 |
| Molecular Formula | C22H30Br2N6O |
| Molecular Weight | 554.33 g/mol |
| Exact Mass | 552.08 |
| IUPAC Name | 1-[(E)-[4-[(1,3-dimethylbenzimidazol-3-ium-2-yl)methoxy]phenyl]methylideneamino]-2,3-diethylguanidine;bromide;hydrobromide |
| SMILES | Br.CC/N=C(\NCC)N/N=C/c1ccc(OCc2n(C)c3ccccc3[n+]2C)cc1.[Br-] |
| InChI | InChI=1S/C22H29N6O.2BrH/c1-5-23-22(24-6-2)26-25-15-17-11-13-18(14-12-17)29-16-21-27(3)19-9-7-8-10-20(19)28(21)4;;/h7-15H,5-6,16H2,1-4H3,(H2,23,24,26);2*1H/q+1;;/p-1/b25-15+;; |
| InChIKey | UZLKPLHJCFTEED-NHLDBBKOSA-M |
| XLogP | 0.07 |
| TPSA | 66.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.33 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|