C14H29NO4 — CID 53320432
(2S,3R,4R,5S)-2-(hydroxymethyl)-1-octylpiperidine-3,4,5-triol (PubChem CID 53320432) has the molecular formula C14H29NO4 and a molecular weight of 275.39 g/mol. Its IUPAC name is (2S,3R,4R,5S)-2-(hydroxymethyl)-1-octylpiperidine-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-octylpiperidine-3,4,5-triol |
|---|---|
| PubChem CID | 53320432 |
| Molecular Formula | C14H29NO4 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | (2S,3R,4R,5S)-2-(hydroxymethyl)-1-octylpiperidine-3,4,5-triol |
| SMILES | CCCCCCCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@@H]1CO |
| InChI | InChI=1S/C14H29NO4/c1-2-3-4-5-6-7-8-15-9-12(17)14(19)13(18)11(15)10-16/h11-14,16-19H,2-10H2,1H3/t11-,12-,13+,14+/m0/s1 |
| InChIKey | VGSQNAQYXKTCLP-IGQOVBAYSA-N |
| XLogP | 0.11 |
| TPSA | 84.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|