About 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate
3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate (PubChem CID 53320585) has the molecular formula C22H23ClO6
and a molecular weight of 418.87 g/mol. Its IUPAC name is 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate.
Molecular Properties
| Compound Name | 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate |
| PubChem CID | 53320585 |
| Molecular Formula | C22H23ClO6 |
| Molecular Weight | 418.87 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate |
| SMILES | COc1ccc(-c2cc3cc(CCCOC(=O)CCl)cc(OC)c3o2)cc1OC |
| InChI | InChI=1S/C22H23ClO6/c1-25-17-7-6-15(11-19(17)26-2)18-12-16-9-14(5-4-8-28-21(24)13-23)10-20(27-3)22(16)29-18/h6-7,9-12H,4-5,8,13H2,1-3H3 |
| InChIKey | QIEVCXUJKXIWRY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 418.87 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate?
The IUPAC name of 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate (CID 53320585) is 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate.
What is the SMILES notation for 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate?
The canonical SMILES for 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate is COc1ccc(-c2cc3cc(CCCOC(=O)CCl)cc(OC)c3o2)cc1OC.
What is the InChIKey of 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate?
The InChIKey is QIEVCXUJKXIWRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23ClO6/c1-25-17-7-6-15(11-19(17)26-2)18-12-16-9-14(5-4-8-28-21(24)13-23)10-20(27-3)22(16)29-18/h6-7,9-12H,4-5,8,13H2,1-3H3.
What are the key properties of 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate?
3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate has a molecular weight of 418.87 g/mol, XLogP of 4.84, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(3,4-dimethoxyphenyl)-7-methoxy-1-benzofuran-5-yl]propyl 2-chloroacetate is sourced from PubChem (CID 53320585), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).